CAS No.: | 27138-31-4 |
---|---|
Transport Package: | 200kg Drum, Isotank |
Specification: | 98% min |
Trademark: | DPGDB |
Origin: | China |
Samples: |
---|
Suppliers with verified business licenses
product Name | di(propylene glycol) dibenzoate |
---|---|
Synonyms | DPGDB; Oxydipropyl dibenzoate; 2-[1-(Benzoyloxy)propan-2-yloxy]propyl benzoate; oxydipropane-3,1-diyl dibenzoate; Dipropylene glycol Dibenzoate; oxydipropane-1,1-diyl dibenzoate |
Molecular Formula | C20H22O5 |
Molecular Weight | 342.3857 |
InChI | InChI=1/C20H22O5/c1-3-17(24-19(21)15-11-7-5-8-12-15)23-18(4-2)25-20(22)16-13-9-6-10-14-16/h5-14,17-18H,3-4H2,1-2H3 |
CAS Registry Number | 27138-31-4 |
EINECS | 248-258-5 |
Molecular Structure |
|
Density | 1.144g/cm3 |
Boiling point | 464.198°C at 760 mmHg |
Refractive index | 1.542 |
Flash point | 202.303°C |
Vapour Pressur | 0mmHg at 25°C |
Suppliers with verified business licenses